C31H42N4O7S — CID 57041163
(3S)-3-[[(2S)-2-[[(4S)-4-acetamido-2-(aminomethyl)-5-methylsulfanyl-3-oxopentanoyl]amino]-3-methylbutanoyl]amino]-7-naphthalen-1-yl-4-oxoheptanoic acid (PubChem CID 57041163) has the molecular formula C31H42N4O7S and a molecular weight of 614.77 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(4S)-4-acetamido-2-(aminomethyl)-5-methylsulfanyl-3-oxopentanoyl]amino]-3-methylbutanoyl]amino]-7-naphthalen-1-yl-4-oxoheptanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[(4S)-4-acetamido-2-(aminomethyl)-5-methylsulfanyl-3-oxopentanoyl]amino]-3-methylbutanoyl]amino]-7-naphthalen-1-yl-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 57041163 |
| Molecular Formula | C31H42N4O7S |
| Molecular Weight | 614.77 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(4S)-4-acetamido-2-(aminomethyl)-5-methylsulfanyl-3-oxopentanoyl]amino]-3-methylbutanoyl]amino]-7-naphthalen-1-yl-4-oxoheptanoic acid |
| SMILES | CSC[C@@H](NC(C)=O)C(=O)C(CN)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)CCCc1cccc2ccccc12)C(C)C |
| InChI | InChI=1S/C31H42N4O7S/c1-18(2)28(35-30(41)23(16-32)29(40)25(17-43-4)33-19(3)36)31(42)34-24(15-27(38)39)26(37)14-8-12-21-11-7-10-20-9-5-6-13-22(20)21/h5-7,9-11,13,18,23-25,28H,8,12,14-17,32H2,1-4H3,(H,33,36)(H,34,42)(H,35,41)(H,38,39)/t23?,24-,25+,28-/m0/s1 |
| InChIKey | ONWNOLLNSUQLRD-ILAPFZNCSA-N |
| XLogP | 1.84 |
| TPSA | 184.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|