C30H39N3O8S — CID 165086369
(3S)-3-[[(5R)-2-(4-aminobutyl)-5-(3-carboxypropanoylamino)-4-oxo-6-sulfanylhexanoyl]amino]-6-naphthalen-1-yl-4-oxohexanoic acid (PubChem CID 165086369) has the molecular formula C30H39N3O8S and a molecular weight of 601.72 g/mol. Its IUPAC name is (3S)-3-[[(5R)-2-(4-aminobutyl)-5-(3-carboxypropanoylamino)-4-oxo-6-sulfanylhexanoyl]amino]-6-naphthalen-1-yl-4-oxohexanoic acid.
| Compound Name | (3S)-3-[[(5R)-2-(4-aminobutyl)-5-(3-carboxypropanoylamino)-4-oxo-6-sulfanylhexanoyl]amino]-6-naphthalen-1-yl-4-oxohexanoic acid |
|---|---|
| PubChem CID | 165086369 |
| Molecular Formula | C30H39N3O8S |
| Molecular Weight | 601.72 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | (3S)-3-[[(5R)-2-(4-aminobutyl)-5-(3-carboxypropanoylamino)-4-oxo-6-sulfanylhexanoyl]amino]-6-naphthalen-1-yl-4-oxohexanoic acid |
| SMILES | NCCCCC(CC(=O)[C@H](CS)NC(=O)CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)CCc1cccc2ccccc12 |
| InChI | InChI=1S/C30H39N3O8S/c31-15-4-3-7-21(16-26(35)24(18-42)32-27(36)13-14-28(37)38)30(41)33-23(17-29(39)40)25(34)12-11-20-9-5-8-19-6-1-2-10-22(19)20/h1-2,5-6,8-10,21,23-24,42H,3-4,7,11-18,31H2,(H,32,36)(H,33,41)(H,37,38)(H,39,40)/t21?,23-,24-/m0/s1 |
| InChIKey | XSICTUKHGAQZPX-BCXZNTRWSA-N |
| XLogP | 2.28 |
| TPSA | 192.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.72 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|