About ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite
ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite (PubChem CID 142848425) has the molecular formula C18H21IO3
and a molecular weight of 412.27 g/mol. Its IUPAC name is ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite.
Molecular Properties
| Compound Name | ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite |
| PubChem CID | 142848425 |
| Molecular Formula | C18H21IO3 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite |
| SMILES | CC.CC.Cc1c2ccc(=O)cc-2oc2cc(OI)ccc12 |
| InChI | InChI=1S/C14H9IO3.2C2H6/c1-8-11-4-2-9(16)6-13(11)17-14-7-10(18-15)3-5-12(8)14;2*1-2/h2-7H,1H3;2*1-2H3 |
| InChIKey | IAUSEHGEENNKFR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite?
The IUPAC name of ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite (CID 142848425) is ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite.
What is the SMILES notation for ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite?
The canonical SMILES for ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite is CC.CC.Cc1c2ccc(=O)cc-2oc2cc(OI)ccc12.
What is the InChIKey of ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite?
The InChIKey is IAUSEHGEENNKFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9IO3.2C2H6/c1-8-11-4-2-9(16)6-13(11)17-14-7-10(18-15)3-5-12(8)14;2*1-2/h2-7H,1H3;2*1-2H3.
What are the key properties of ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite?
ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite has a molecular weight of 412.27 g/mol, XLogP of 5.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(9-methyl-6-oxoxanthen-3-yl) hypoiodite is sourced from PubChem (CID 142848425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).