C22H17O5- — CID 59103456
2-(3-methoxy-6-oxoxanthen-9-yl)-5-methylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 59103456) has the molecular formula C22H17O5- and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-(3-methoxy-6-oxoxanthen-9-yl)-5-methylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | 2-(3-methoxy-6-oxoxanthen-9-yl)-5-methylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 59103456 |
| Molecular Formula | C22H17O5- |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-(3-methoxy-6-oxoxanthen-9-yl)-5-methylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | COc1ccc2c(C3=CC=C(C)CC3C(=O)[O-])c3ccc(=O)cc-3oc2c1 |
| InChI | InChI=1S/C22H18O5/c1-12-3-6-15(18(9-12)22(24)25)21-16-7-4-13(23)10-19(16)27-20-11-14(26-2)5-8-17(20)21/h3-8,10-11,18H,9H2,1-2H3,(H,24,25)/p-1 |
| InChIKey | HKKDIFIZFXTVTL-UHFFFAOYSA-M |
| XLogP | 3.01 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|