C18H11NO4S — CID 142850007
S-[(Z)-1-(9,10-dioxoanthracen-2-yl)-3-oxoprop-1-en-2-yl] carbamothioate (PubChem CID 142850007) has the molecular formula C18H11NO4S and a molecular weight of 337.36 g/mol. Its IUPAC name is S-[(Z)-1-(9,10-dioxoanthracen-2-yl)-3-oxoprop-1-en-2-yl] carbamothioate.
| Compound Name | S-[(Z)-1-(9,10-dioxoanthracen-2-yl)-3-oxoprop-1-en-2-yl] carbamothioate |
|---|---|
| PubChem CID | 142850007 |
| Molecular Formula | C18H11NO4S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | S-[(Z)-1-(9,10-dioxoanthracen-2-yl)-3-oxoprop-1-en-2-yl] carbamothioate |
| SMILES | NC(=O)S/C(C=O)=C\c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H11NO4S/c19-18(23)24-11(9-20)7-10-5-6-14-15(8-10)17(22)13-4-2-1-3-12(13)16(14)21/h1-9H,(H2,19,23)/b11-7- |
| InChIKey | WGAKHJPBRLEEFU-XFFZJAGNSA-N |
| XLogP | 2.81 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|