About (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate
(E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate (PubChem CID 7324714) has the molecular formula C23H13O4-
and a molecular weight of 353.35 g/mol. Its IUPAC name is (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate.
Molecular Properties
| Compound Name | (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate |
| PubChem CID | 7324714 |
| Molecular Formula | C23H13O4- |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate |
| SMILES | O=C([O-])/C(=C/c1ccc2c(c1)C(=O)c1ccccc1C2=O)c1ccccc1 |
| InChI | InChI=1S/C23H14O4/c24-21-16-8-4-5-9-17(16)22(25)20-13-14(10-11-18(20)21)12-19(23(26)27)15-6-2-1-3-7-15/h1-13H,(H,26,27)/p-1/b19-12+ |
| InChIKey | WRBCIIWWCLHEEB-XDHOZWIPSA-M |
| XLogP | 2.75 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate?
The IUPAC name of (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate (CID 7324714) is (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate.
What is the SMILES notation for (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate?
The canonical SMILES for (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate is O=C([O-])/C(=C/c1ccc2c(c1)C(=O)c1ccccc1C2=O)c1ccccc1.
What is the InChIKey of (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate?
The InChIKey is WRBCIIWWCLHEEB-XDHOZWIPSA-M. The full InChI is InChI=1S/C23H14O4/c24-21-16-8-4-5-9-17(16)22(25)20-13-14(10-11-18(20)21)12-19(23(26)27)15-6-2-1-3-7-15/h1-13H,(H,26,27)/p-1/b19-12+.
What are the key properties of (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate?
(E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate has a molecular weight of 353.35 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate is sourced from PubChem (CID 7324714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).