C23H13O4- — CID 7324714
(E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate (PubChem CID 7324714) has the molecular formula C23H13O4- and a molecular weight of 353.35 g/mol. Its IUPAC name is (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate.
| Compound Name | (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7324714 |
| Molecular Formula | C23H13O4- |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (E)-3-(9,10-dioxoanthracen-2-yl)-2-phenylprop-2-enoate |
| SMILES | O=C([O-])/C(=C/c1ccc2c(c1)C(=O)c1ccccc1C2=O)c1ccccc1 |
| InChI | InChI=1S/C23H14O4/c24-21-16-8-4-5-9-17(16)22(25)20-13-14(10-11-18(20)21)12-19(23(26)27)15-6-2-1-3-7-15/h1-13H,(H,26,27)/p-1/b19-12+ |
| InChIKey | WRBCIIWWCLHEEB-XDHOZWIPSA-M |
| XLogP | 2.75 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|