C23H23NO3 — CID 142852821
2-methoxy-6-[1-[3-(2-phenylethoxy)anilino]ethenyl]phenol (PubChem CID 142852821) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-methoxy-6-[1-[3-(2-phenylethoxy)anilino]ethenyl]phenol.
| Compound Name | 2-methoxy-6-[1-[3-(2-phenylethoxy)anilino]ethenyl]phenol |
|---|---|
| PubChem CID | 142852821 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-methoxy-6-[1-[3-(2-phenylethoxy)anilino]ethenyl]phenol |
| SMILES | C=C(Nc1cccc(OCCc2ccccc2)c1)c1cccc(OC)c1O |
| InChI | InChI=1S/C23H23NO3/c1-17(21-12-7-13-22(26-2)23(21)25)24-19-10-6-11-20(16-19)27-15-14-18-8-4-3-5-9-18/h3-13,16,24-25H,1,14-15H2,2H3 |
| InChIKey | PUUVYHORYOPBGC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |