C26H26N2O2 — CID 142852975
N-[2-ethenyl-3-[1-[3-(2-phenylethoxy)anilino]ethenyl]phenyl]acetamide (PubChem CID 142852975) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[2-ethenyl-3-[1-[3-(2-phenylethoxy)anilino]ethenyl]phenyl]acetamide.
| Compound Name | N-[2-ethenyl-3-[1-[3-(2-phenylethoxy)anilino]ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 142852975 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[2-ethenyl-3-[1-[3-(2-phenylethoxy)anilino]ethenyl]phenyl]acetamide |
| SMILES | C=Cc1c(NC(C)=O)cccc1C(=C)Nc1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C26H26N2O2/c1-4-24-25(14-9-15-26(24)28-20(3)29)19(2)27-22-12-8-13-23(18-22)30-17-16-21-10-6-5-7-11-21/h4-15,18,27H,1-2,16-17H2,3H3,(H,28,29) |
| InChIKey | VDUGCGJJSBTFJC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |