C18H23NO2 — CID 142853469
(2E)-N-[(3-ethylphenyl)methyl]-2-[(E)-1-methoxyprop-1-enyl]penta-2,4-dienamide (PubChem CID 142853469) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (2E)-N-[(3-ethylphenyl)methyl]-2-[(E)-1-methoxyprop-1-enyl]penta-2,4-dienamide.
| Compound Name | (2E)-N-[(3-ethylphenyl)methyl]-2-[(E)-1-methoxyprop-1-enyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 142853469 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (2E)-N-[(3-ethylphenyl)methyl]-2-[(E)-1-methoxyprop-1-enyl]penta-2,4-dienamide |
| SMILES | C=C/C=C(C(=O)NCc1cccc(CC)c1)\C(=C/C)OC |
| InChI | InChI=1S/C18H23NO2/c1-5-9-16(17(7-3)21-4)18(20)19-13-15-11-8-10-14(6-2)12-15/h5,7-12H,1,6,13H2,2-4H3,(H,19,20)/b16-9+,17-7+ |
| InChIKey | SINFOUZWUYNFCK-WPGKKOIMSA-N |
| XLogP | 3.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|