About butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene
butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene (PubChem CID 142853948) has the molecular formula C18H26S
and a molecular weight of 274.47 g/mol. Its IUPAC name is butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene.
Molecular Properties
| Compound Name | butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene |
| PubChem CID | 142853948 |
| Molecular Formula | C18H26S |
| Molecular Weight | 274.47 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene |
| SMILES | C=Cc1ccc(/C(C)=C/SC(=C)C)cc1.CCCC |
| InChI | InChI=1S/C14H16S.C4H10/c1-5-13-6-8-14(9-7-13)12(4)10-15-11(2)3;1-3-4-2/h5-10H,1-2H2,3-4H3;3-4H2,1-2H3/b12-10+; |
| InChIKey | ISYRSUUSMLGXJW-VHPXAQPISA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.47 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene?
The IUPAC name of butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene (CID 142853948) is butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene.
What is the SMILES notation for butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene?
The canonical SMILES for butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene is C=Cc1ccc(/C(C)=C/SC(=C)C)cc1.CCCC.
What is the InChIKey of butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene?
The InChIKey is ISYRSUUSMLGXJW-VHPXAQPISA-N. The full InChI is InChI=1S/C14H16S.C4H10/c1-5-13-6-8-14(9-7-13)12(4)10-15-11(2)3;1-3-4-2/h5-10H,1-2H2,3-4H3;3-4H2,1-2H3/b12-10+;.
What are the key properties of butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene?
butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene has a molecular weight of 274.47 g/mol, XLogP of 6.76, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-ethenyl-4-[(E)-1-prop-1-en-2-ylsulfanylprop-1-en-2-yl]benzene is sourced from PubChem (CID 142853948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).