About butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane
butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane (PubChem CID 142178800) has the molecular formula C23H29ClOS
and a molecular weight of 389.00 g/mol. Its IUPAC name is butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane.
Molecular Properties
| Compound Name | butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane |
| PubChem CID | 142178800 |
| Molecular Formula | C23H29ClOS |
| Molecular Weight | 389.00 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane |
| SMILES | C=C(S/C=C(\C)c1ccc(Cl)cc1)c1ccccc1.CC.CCC(C)=O |
| InChI | InChI=1S/C17H15ClS.C4H8O.C2H6/c1-13(15-8-10-17(18)11-9-15)12-19-14(2)16-6-4-3-5-7-16;1-3-4(2)5;1-2/h3-12H,2H2,1H3;3H2,1-2H3;1-2H3/b13-12+;; |
| InChIKey | ZQWOWAXEJAFMAU-HPAIREQNSA-N |
| XLogP | 8.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.00 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane?
The IUPAC name of butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane (CID 142178800) is butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane.
What is the SMILES notation for butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane?
The canonical SMILES for butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane is C=C(S/C=C(\C)c1ccc(Cl)cc1)c1ccccc1.CC.CCC(C)=O.
What is the InChIKey of butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane?
The InChIKey is ZQWOWAXEJAFMAU-HPAIREQNSA-N. The full InChI is InChI=1S/C17H15ClS.C4H8O.C2H6/c1-13(15-8-10-17(18)11-9-15)12-19-14(2)16-6-4-3-5-7-16;1-3-4(2)5;1-2/h3-12H,2H2,1H3;3H2,1-2H3;1-2H3/b13-12+;;.
What are the key properties of butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane?
butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane has a molecular weight of 389.00 g/mol, XLogP of 8.12, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;1-chloro-4-[(E)-1-(1-phenylethenylsulfanyl)prop-1-en-2-yl]benzene;ethane is sourced from PubChem (CID 142178800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).