C11H9FS — CID 142854089
3-(5-fluorocyclohexa-1,5-dien-1-yl)thiopyran (PubChem CID 142854089) has the molecular formula C11H9FS and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-(5-fluorocyclohexa-1,5-dien-1-yl)thiopyran.
| Compound Name | 3-(5-fluorocyclohexa-1,5-dien-1-yl)thiopyran |
|---|---|
| PubChem CID | 142854089 |
| Molecular Formula | C11H9FS |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 3-(5-fluorocyclohexa-1,5-dien-1-yl)thiopyran |
| SMILES | FC1=CC(C2=CSC=C=C2)=CCC1 |
| InChI | InChI=1S/C11H9FS/c12-11-5-1-3-9(7-11)10-4-2-6-13-8-10/h3-4,6-8H,1,5H2 |
| InChIKey | IZPDYDFUSWXCLJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |