C7H9FS — CID 88562313
(4-fluorocyclohexa-1,5-dien-1-yl)methanethiol (PubChem CID 88562313) has the molecular formula C7H9FS and a molecular weight of 144.21 g/mol. Its IUPAC name is (4-fluorocyclohexa-1,5-dien-1-yl)methanethiol.
| Compound Name | (4-fluorocyclohexa-1,5-dien-1-yl)methanethiol |
|---|---|
| PubChem CID | 88562313 |
| Molecular Formula | C7H9FS |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (4-fluorocyclohexa-1,5-dien-1-yl)methanethiol |
| SMILES | FC1C=CC(CS)=CC1 |
| InChI | InChI=1S/C7H9FS/c8-7-3-1-6(5-9)2-4-7/h1-3,7,9H,4-5H2 |
| InChIKey | KUTSMIWAPKSEJM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|