C8H13NO3S — CID 142857345
(1E,3E,5Z)-4-(methylamino)hepta-1,3,5-triene-1-sulfonic acid (PubChem CID 142857345) has the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is (1E,3E,5Z)-4-(methylamino)hepta-1,3,5-triene-1-sulfonic acid.
| Compound Name | (1E,3E,5Z)-4-(methylamino)hepta-1,3,5-triene-1-sulfonic acid |
|---|---|
| PubChem CID | 142857345 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | (1E,3E,5Z)-4-(methylamino)hepta-1,3,5-triene-1-sulfonic acid |
| SMILES | C/C=C\C(=C/C=C/S(=O)(=O)O)NC |
| InChI | InChI=1S/C8H13NO3S/c1-3-5-8(9-2)6-4-7-13(10,11)12/h3-7,9H,1-2H3,(H,10,11,12)/b5-3-,7-4+,8-6+ |
| InChIKey | BOYBGACLRCBMHY-MCEUHYDUSA-N |
| XLogP | 1.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|