C6H10N2 — CID 142858780
(5E)-5-ethylidene-2-methyl-1,4-dihydroimidazole (PubChem CID 142858780) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is (5E)-5-ethylidene-2-methyl-1,4-dihydroimidazole.
| Compound Name | (5E)-5-ethylidene-2-methyl-1,4-dihydroimidazole |
|---|---|
| PubChem CID | 142858780 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | (5E)-5-ethylidene-2-methyl-1,4-dihydroimidazole |
| SMILES | C/C=C1\CN=C(C)N1 |
| InChI | InChI=1S/C6H10N2/c1-3-6-4-7-5(2)8-6/h3H,4H2,1-2H3,(H,7,8)/b6-3+ |
| InChIKey | MQXFMNPTJWSAEE-ZZXKWVIFSA-N |
| XLogP | 0.91 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |