C15H29NO2 — CID 142863442
but-1-ene;tert-butyl N-ethylcarbamate;but-1-yne (PubChem CID 142863442) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is but-1-ene;tert-butyl N-ethylcarbamate;but-1-yne.
| Compound Name | but-1-ene;tert-butyl N-ethylcarbamate;but-1-yne |
|---|---|
| PubChem CID | 142863442 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | but-1-ene;tert-butyl N-ethylcarbamate;but-1-yne |
| SMILES | C#CCC.C=CCC.CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C7H15NO2.C4H8.C4H6/c1-5-8-6(9)10-7(2,3)4;2*1-3-4-2/h5H2,1-4H3,(H,8,9);3H,1,4H2,2H3;1H,4H2,2H3 |
| InChIKey | NHQDGADCTPZBJY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|