C16H29NO — CID 142863538
6-[(1Z)-buta-1,3-dienyl]-1,2,5-trimethyl-2,3-dihydropyridin-4-one;ethane (PubChem CID 142863538) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 6-[(1Z)-buta-1,3-dienyl]-1,2,5-trimethyl-2,3-dihydropyridin-4-one;ethane.
| Compound Name | 6-[(1Z)-buta-1,3-dienyl]-1,2,5-trimethyl-2,3-dihydropyridin-4-one;ethane |
|---|---|
| PubChem CID | 142863538 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 6-[(1Z)-buta-1,3-dienyl]-1,2,5-trimethyl-2,3-dihydropyridin-4-one;ethane |
| SMILES | C=C/C=C\C1=C(C)C(=O)CC(C)N1C.CC.CC |
| InChI | InChI=1S/C12H17NO.2C2H6/c1-5-6-7-11-10(3)12(14)8-9(2)13(11)4;2*1-2/h5-7,9H,1,8H2,2-4H3;2*1-2H3/b7-6-;; |
| InChIKey | KGEVZEBCXDKIRQ-AQTVDGORSA-N |
| XLogP | 4.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|