C17H23NO2 — CID 91579620
3-[4-(azepan-1-yl)cyclohexa-2,4-dien-1-ylidene]pentane-2,4-dione (PubChem CID 91579620) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-[4-(azepan-1-yl)cyclohexa-2,4-dien-1-ylidene]pentane-2,4-dione.
| Compound Name | 3-[4-(azepan-1-yl)cyclohexa-2,4-dien-1-ylidene]pentane-2,4-dione |
|---|---|
| PubChem CID | 91579620 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-[4-(azepan-1-yl)cyclohexa-2,4-dien-1-ylidene]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)=C1C=CC(N2CCCCCC2)=CC1 |
| InChI | InChI=1S/C17H23NO2/c1-13(19)17(14(2)20)15-7-9-16(10-8-15)18-11-5-3-4-6-12-18/h7,9-10H,3-6,8,11-12H2,1-2H3 |
| InChIKey | DMIZHBJCDMYCTG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|