C23H32F3N3O2 — CID 142866709
ethyl (E)-3-[amino(methyl)amino]-3-[[1-[3-[(Z)-but-2-enyl]-4-ethenylphenyl]-4,4,4-trifluorobutyl]amino]-2-methylprop-2-enoate (PubChem CID 142866709) has the molecular formula C23H32F3N3O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is ethyl (E)-3-[amino(methyl)amino]-3-[[1-[3-[(Z)-but-2-enyl]-4-ethenylphenyl]-4,4,4-trifluorobutyl]amino]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[amino(methyl)amino]-3-[[1-[3-[(Z)-but-2-enyl]-4-ethenylphenyl]-4,4,4-trifluorobutyl]amino]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142866709 |
| Molecular Formula | C23H32F3N3O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | ethyl (E)-3-[amino(methyl)amino]-3-[[1-[3-[(Z)-but-2-enyl]-4-ethenylphenyl]-4,4,4-trifluorobutyl]amino]-2-methylprop-2-enoate |
| SMILES | C=Cc1ccc(C(CCC(F)(F)F)N/C(=C(/C)C(=O)OCC)N(C)N)cc1C/C=C\C |
| InChI | InChI=1S/C23H32F3N3O2/c1-6-9-10-18-15-19(12-11-17(18)7-2)20(13-14-23(24,25)26)28-21(29(5)27)16(4)22(30)31-8-3/h6-7,9,11-12,15,20,28H,2,8,10,13-14,27H2,1,3-5H3/b9-6-,21-16+ |
| InChIKey | BOIHRFWRZYMBSI-ZLJXKSONSA-N |
| XLogP | 5.02 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|