C10H18 — CID 142867199
1,5-dimethylcyclohexa-1,2-diene;ethane (PubChem CID 142867199) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is 1,5-dimethylcyclohexa-1,2-diene;ethane.
| Compound Name | 1,5-dimethylcyclohexa-1,2-diene;ethane |
|---|---|
| PubChem CID | 142867199 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | 1,5-dimethylcyclohexa-1,2-diene;ethane |
| SMILES | CC.CC1=C=CCC(C)C1 |
| InChI | InChI=1S/C8H12.C2H6/c1-7-4-3-5-8(2)6-7;1-2/h3,7H,4,6H2,1-2H3;1-2H3 |
| InChIKey | KCNGECDCXSPMQQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |