C16H27BrO2 — CID 142869005
5-(3-bromoprop-1-en-2-yl)-2-ethyl-6-methoxy-3-methyl-3-propan-2-ylcyclohexan-1-one (PubChem CID 142869005) has the molecular formula C16H27BrO2 and a molecular weight of 331.29 g/mol. Its IUPAC name is 5-(3-bromoprop-1-en-2-yl)-2-ethyl-6-methoxy-3-methyl-3-propan-2-ylcyclohexan-1-one.
| Compound Name | 5-(3-bromoprop-1-en-2-yl)-2-ethyl-6-methoxy-3-methyl-3-propan-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 142869005 |
| Molecular Formula | C16H27BrO2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 5-(3-bromoprop-1-en-2-yl)-2-ethyl-6-methoxy-3-methyl-3-propan-2-ylcyclohexan-1-one |
| SMILES | C=C(CBr)C1CC(C)(C(C)C)C(CC)C(=O)C1OC |
| InChI | InChI=1S/C16H27BrO2/c1-7-13-14(18)15(19-6)12(11(4)9-17)8-16(13,5)10(2)3/h10,12-13,15H,4,7-9H2,1-3,5-6H3 |
| InChIKey | BBBNOGIBOSGGBV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|