C16H18N4O — CID 142872957
5-[(E)-3-amino-1-iminobut-2-en-2-yl]oxybenzene-1,3-dicarbonitrile;methylcyclopropane (PubChem CID 142872957) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 5-[(E)-3-amino-1-iminobut-2-en-2-yl]oxybenzene-1,3-dicarbonitrile;methylcyclopropane.
| Compound Name | 5-[(E)-3-amino-1-iminobut-2-en-2-yl]oxybenzene-1,3-dicarbonitrile;methylcyclopropane |
|---|---|
| PubChem CID | 142872957 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 5-[(E)-3-amino-1-iminobut-2-en-2-yl]oxybenzene-1,3-dicarbonitrile;methylcyclopropane |
| SMILES | CC1CC1.[H]/N=C/C(Oc1cc(C#N)cc(C#N)c1)=C(/C)N |
| InChI | InChI=1S/C12H10N4O.C4H8/c1-8(16)12(7-15)17-11-3-9(5-13)2-10(4-11)6-14;1-4-2-3-4/h2-4,7,15H,16H2,1H3;4H,2-3H2,1H3/b12-8+,15-7+; |
| InChIKey | XSVCJTLZHIXAIB-LLKPJUPMSA-N |
| XLogP | 3.06 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|