C15H20F2N2O4 — CID 142875207
ethyl (2S)-2-[(3,4-difluoro-2-hydroxyphenyl)carbamoylamino]-4-methylpentanoate (PubChem CID 142875207) has the molecular formula C15H20F2N2O4 and a molecular weight of 330.33 g/mol. Its IUPAC name is ethyl (2S)-2-[(3,4-difluoro-2-hydroxyphenyl)carbamoylamino]-4-methylpentanoate.
| Compound Name | ethyl (2S)-2-[(3,4-difluoro-2-hydroxyphenyl)carbamoylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 142875207 |
| Molecular Formula | C15H20F2N2O4 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | ethyl (2S)-2-[(3,4-difluoro-2-hydroxyphenyl)carbamoylamino]-4-methylpentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)NC(=O)Nc1ccc(F)c(F)c1O |
| InChI | InChI=1S/C15H20F2N2O4/c1-4-23-14(21)11(7-8(2)3)19-15(22)18-10-6-5-9(16)12(17)13(10)20/h5-6,8,11,20H,4,7H2,1-3H3,(H2,18,19,22)/t11-/m0/s1 |
| InChIKey | QNJDFEQRFZFRIX-NSHDSACASA-N |
| XLogP | 2.77 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|