About sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate
sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 142875270) has the molecular formula C8H11NaO6
and a molecular weight of 226.16 g/mol. Its IUPAC name is sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate.
Molecular Properties
| Compound Name | sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate |
| PubChem CID | 142875270 |
| Molecular Formula | C8H11NaO6 |
| Molecular Weight | 226.16 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | O=C([O-])C1=CC(O)C(O)C(CCO)O1.[Na+] |
| InChI | InChI=1S/C8H12O6.Na/c9-2-1-5-7(11)4(10)3-6(14-5)8(12)13;/h3-5,7,9-11H,1-2H2,(H,12,13);/q;+1/p-1 |
| InChIKey | XXJFFRMHRGUTKI-UHFFFAOYSA-M |
| XLogP | -5.87 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.16 |
| LogP ≤ 5 | -5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate?
The IUPAC name of sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate (CID 142875270) is sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate.
What is the SMILES notation for sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate?
The canonical SMILES for sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate is O=C([O-])C1=CC(O)C(O)C(CCO)O1.[Na+].
What is the InChIKey of sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate?
The InChIKey is XXJFFRMHRGUTKI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H12O6.Na/c9-2-1-5-7(11)4(10)3-6(14-5)8(12)13;/h3-5,7,9-11H,1-2H2,(H,12,13);/q;+1/p-1.
What are the key properties of sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate?
sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate has a molecular weight of 226.16 g/mol, XLogP of -5.87, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3,4-dihydroxy-2-(2-hydroxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate is sourced from PubChem (CID 142875270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).