C8H11N3 — CID 142875349
5-[(Z)-but-1-enyl]-1-ethenyl-1,2,4-triazole (PubChem CID 142875349) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 5-[(Z)-but-1-enyl]-1-ethenyl-1,2,4-triazole.
| Compound Name | 5-[(Z)-but-1-enyl]-1-ethenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 142875349 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 5-[(Z)-but-1-enyl]-1-ethenyl-1,2,4-triazole |
| SMILES | C=Cn1ncnc1/C=C\CC |
| InChI | InChI=1S/C8H11N3/c1-3-5-6-8-9-7-10-11(8)4-2/h4-7H,2-3H2,1H3/b6-5- |
| InChIKey | DABBMAXYYCSAGG-WAYWQWQTSA-N |
| XLogP | 1.80 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |