C25H31ClO5 — CID 142875646
methyl 4-[3-[(1S,2R,5R)-5-chloro-2-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3-oxocyclopentyl]-2-hydroxyphenyl]butanoate (PubChem CID 142875646) has the molecular formula C25H31ClO5 and a molecular weight of 446.97 g/mol. Its IUPAC name is methyl 4-[3-[(1S,2R,5R)-5-chloro-2-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3-oxocyclopentyl]-2-hydroxyphenyl]butanoate.
| Compound Name | methyl 4-[3-[(1S,2R,5R)-5-chloro-2-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3-oxocyclopentyl]-2-hydroxyphenyl]butanoate |
|---|---|
| PubChem CID | 142875646 |
| Molecular Formula | C25H31ClO5 |
| Molecular Weight | 446.97 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | methyl 4-[3-[(1S,2R,5R)-5-chloro-2-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3-oxocyclopentyl]-2-hydroxyphenyl]butanoate |
| SMILES | CC#CCC(C)C(O)/C=C/[C@H]1C(=O)C[C@@H](Cl)[C@@H]1c1cccc(CCCC(=O)OC)c1O |
| InChI | InChI=1S/C25H31ClO5/c1-4-5-8-16(2)21(27)14-13-18-22(28)15-20(26)24(18)19-11-6-9-17(25(19)30)10-7-12-23(29)31-3/h6,9,11,13-14,16,18,20-21,24,27,30H,7-8,10,12,15H2,1-3H3/b14-13+/t16?,18-,20+,21?,24-/m0/s1 |
| InChIKey | FKQYCQPXVURSCU-OSKQNBBQSA-N |
| XLogP | 4.13 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.97 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|