C27H40O4 — CID 145379590
ethane;methyl 4-[2-hydroxy-3-[(1S,3R)-3-hydroxy-2-[(E)-4-methyloct-1-en-6-ynyl]cyclopentyl]phenyl]butanoate (PubChem CID 145379590) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is ethane;methyl 4-[2-hydroxy-3-[(1S,3R)-3-hydroxy-2-[(E)-4-methyloct-1-en-6-ynyl]cyclopentyl]phenyl]butanoate.
| Compound Name | ethane;methyl 4-[2-hydroxy-3-[(1S,3R)-3-hydroxy-2-[(E)-4-methyloct-1-en-6-ynyl]cyclopentyl]phenyl]butanoate |
|---|---|
| PubChem CID | 145379590 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | ethane;methyl 4-[2-hydroxy-3-[(1S,3R)-3-hydroxy-2-[(E)-4-methyloct-1-en-6-ynyl]cyclopentyl]phenyl]butanoate |
| SMILES | CC.CC#CCC(C)C/C=C/C1[C@H](O)CC[C@@H]1c1cccc(CCCC(=O)OC)c1O |
| InChI | InChI=1S/C25H34O4.C2H6/c1-4-5-9-18(2)10-6-13-21-20(16-17-23(21)26)22-14-7-11-19(25(22)28)12-8-15-24(27)29-3;1-2/h6-7,11,13-14,18,20-21,23,26,28H,8-10,12,15-17H2,1-3H3;1-2H3/b13-6+;/t18?,20-,21?,23+;/m0./s1 |
| InChIKey | OTKCICNPLRNYSF-WIWZAMDGSA-N |
| XLogP | 5.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|