C26H34N8O3 — CID 142877492
6-[[(3Z)-3-[(E)-2-[2-(aminomethylideneamino)ethyl-methylcarbamoyl]but-2-enylidene]-1,2-dihydropyrrole-5-carbonyl]amino]-N-[2-(methylamino)ethyl]-1H-indole-2-carboxamide (PubChem CID 142877492) has the molecular formula C26H34N8O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is 6-[[(3Z)-3-[(E)-2-[2-(aminomethylideneamino)ethyl-methylcarbamoyl]but-2-enylidene]-1,2-dihydropyrrole-5-carbonyl]amino]-N-[2-(methylamino)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 6-[[(3Z)-3-[(E)-2-[2-(aminomethylideneamino)ethyl-methylcarbamoyl]but-2-enylidene]-1,2-dihydropyrrole-5-carbonyl]amino]-N-[2-(methylamino)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 142877492 |
| Molecular Formula | C26H34N8O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 6-[[(3Z)-3-[(E)-2-[2-(aminomethylideneamino)ethyl-methylcarbamoyl]but-2-enylidene]-1,2-dihydropyrrole-5-carbonyl]amino]-N-[2-(methylamino)ethyl]-1H-indole-2-carboxamide |
| SMILES | C/C=C(\C=C1\C=C(C(=O)Nc2ccc3cc(C(=O)NCCNC)[nH]c3c2)NC1)C(=O)N(C)CC/N=C/N |
| InChI | InChI=1S/C26H34N8O3/c1-4-18(26(37)34(3)10-9-29-16-27)11-17-12-22(31-15-17)25(36)32-20-6-5-19-13-23(33-21(19)14-20)24(35)30-8-7-28-2/h4-6,11-14,16,28,31,33H,7-10,15H2,1-3H3,(H2,27,29)(H,30,35)(H,32,36)/b17-11-,18-4+ |
| InChIKey | IIKINBPQCGFJGI-YLTTXBIZSA-N |
| XLogP | 0.86 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|