C28H25N2O2P — CID 142879776
phenyl-bis[2-(4-phenyl-1,3-oxazol-2-yl)ethyl]phosphane (PubChem CID 142879776) has the molecular formula C28H25N2O2P and a molecular weight of 452.49 g/mol. Its IUPAC name is phenyl-bis[2-(4-phenyl-1,3-oxazol-2-yl)ethyl]phosphane.
| Compound Name | phenyl-bis[2-(4-phenyl-1,3-oxazol-2-yl)ethyl]phosphane |
|---|---|
| PubChem CID | 142879776 |
| Molecular Formula | C28H25N2O2P |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | phenyl-bis[2-(4-phenyl-1,3-oxazol-2-yl)ethyl]phosphane |
| SMILES | c1ccc(-c2coc(CCP(CCc3nc(-c4ccccc4)co3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C28H25N2O2P/c1-4-10-22(11-5-1)25-20-31-27(29-25)16-18-33(24-14-8-3-9-15-24)19-17-28-30-26(21-32-28)23-12-6-2-7-13-23/h1-15,20-21H,16-19H2 |
| InChIKey | NCODPTXXWMACJU-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|