C17H22FN5O — CID 142879975
(1E,3Z)-5-[2-(6-fluoro-2-pyridinyl)imidazol-1-yl]-1-methoxy-3-propylpenta-1,3-diene-1,4-diamine (PubChem CID 142879975) has the molecular formula C17H22FN5O and a molecular weight of 331.40 g/mol. Its IUPAC name is (1E,3Z)-5-[2-(6-fluoro-2-pyridinyl)imidazol-1-yl]-1-methoxy-3-propylpenta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-5-[2-(6-fluoro-2-pyridinyl)imidazol-1-yl]-1-methoxy-3-propylpenta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 142879975 |
| Molecular Formula | C17H22FN5O |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (1E,3Z)-5-[2-(6-fluoro-2-pyridinyl)imidazol-1-yl]-1-methoxy-3-propylpenta-1,3-diene-1,4-diamine |
| SMILES | CCCC(/C=C(\N)OC)=C(/N)Cn1ccnc1-c1cccc(F)n1 |
| InChI | InChI=1S/C17H22FN5O/c1-3-5-12(10-16(20)24-2)13(19)11-23-9-8-21-17(23)14-6-4-7-15(18)22-14/h4,6-10H,3,5,11,19-20H2,1-2H3/b13-12-,16-10+ |
| InChIKey | ODLXANYFBQWDDS-UNUWOKCVSA-N |
| XLogP | 2.54 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|