C19H31N5O — CID 142879982
(Z,7Z)-5-amino-7-[1-amino-2-(2-prop-2-enimidoylimidazol-1-yl)ethylidene]-2-methyldec-5-en-2-ol (PubChem CID 142879982) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is (Z,7Z)-5-amino-7-[1-amino-2-(2-prop-2-enimidoylimidazol-1-yl)ethylidene]-2-methyldec-5-en-2-ol.
| Compound Name | (Z,7Z)-5-amino-7-[1-amino-2-(2-prop-2-enimidoylimidazol-1-yl)ethylidene]-2-methyldec-5-en-2-ol |
|---|---|
| PubChem CID | 142879982 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | (Z,7Z)-5-amino-7-[1-amino-2-(2-prop-2-enimidoylimidazol-1-yl)ethylidene]-2-methyldec-5-en-2-ol |
| SMILES | [H]/N=C(\C=C)c1nccn1C/C(N)=C(/C=C(\N)CCC(C)(C)O)CCC |
| InChI | InChI=1S/C19H31N5O/c1-5-7-14(12-15(20)8-9-19(3,4)25)17(22)13-24-11-10-23-18(24)16(21)6-2/h6,10-12,21,25H,2,5,7-9,13,20,22H2,1,3-4H3/b15-12-,17-14-,21-16+ |
| InChIKey | SASKYKWGFBFQJB-GLPCSJQQSA-N |
| XLogP | 2.84 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|