C17H23N7 — CID 142996640
3-methanimidoyl-6-[(2-pent-4-enimidoylimidazol-1-yl)methyl]-5-propylpyrimidin-4-imine (PubChem CID 142996640) has the molecular formula C17H23N7 and a molecular weight of 325.42 g/mol. Its IUPAC name is 3-methanimidoyl-6-[(2-pent-4-enimidoylimidazol-1-yl)methyl]-5-propylpyrimidin-4-imine.
| Compound Name | 3-methanimidoyl-6-[(2-pent-4-enimidoylimidazol-1-yl)methyl]-5-propylpyrimidin-4-imine |
|---|---|
| PubChem CID | 142996640 |
| Molecular Formula | C17H23N7 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 3-methanimidoyl-6-[(2-pent-4-enimidoylimidazol-1-yl)methyl]-5-propylpyrimidin-4-imine |
| SMILES | [H]/N=c1/c(CCC)c(Cn2ccnc2/C(CCC=C)=N/[H])ncn1/C=N/[H] |
| InChI | InChI=1S/C17H23N7/c1-3-5-7-14(19)17-21-8-9-23(17)10-15-13(6-4-2)16(20)24(11-18)12-22-15/h3,8-9,11-12,18-20H,1,4-7,10H2,2H3/b18-11+,19-14+,20-16- |
| InChIKey | ZTKGCECHRFSNMK-BBBPSXCGSA-N |
| XLogP | 2.35 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|