C24H29N5 — CID 153338420
(9Z)-8-cyclohepta-1,6-dien-1-yl-9-(3,7-dimethyl-1,2-dihydroazepin-5-ylidene)-N-ethyl-5H-imidazo[1,2-d][1,4]diazepin-6-imine (PubChem CID 153338420) has the molecular formula C24H29N5 and a molecular weight of 387.53 g/mol. Its IUPAC name is (9Z)-8-cyclohepta-1,6-dien-1-yl-9-(3,7-dimethyl-1,2-dihydroazepin-5-ylidene)-N-ethyl-5H-imidazo[1,2-d][1,4]diazepin-6-imine.
| Compound Name | (9Z)-8-cyclohepta-1,6-dien-1-yl-9-(3,7-dimethyl-1,2-dihydroazepin-5-ylidene)-N-ethyl-5H-imidazo[1,2-d][1,4]diazepin-6-imine |
|---|---|
| PubChem CID | 153338420 |
| Molecular Formula | C24H29N5 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (9Z)-8-cyclohepta-1,6-dien-1-yl-9-(3,7-dimethyl-1,2-dihydroazepin-5-ylidene)-N-ethyl-5H-imidazo[1,2-d][1,4]diazepin-6-imine |
| SMILES | CC/N=C1\Cn2ccnc2/C(=C2/C=C(C)CNC(C)=C2)C(C2=CCCCC=C2)=N1 |
| InChI | InChI=1S/C24H29N5/c1-4-25-21-16-29-12-11-26-24(29)22(20-13-17(2)15-27-18(3)14-20)23(28-21)19-9-7-5-6-8-10-19/h7,9-14,27H,4-6,8,15-16H2,1-3H3/b22-20-,25-21+ |
| InChIKey | WZTPAQBRBZUMTQ-PQPJQSNGSA-N |
| XLogP | 4.63 |
| TPSA | 54.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|