C14H16BrNO3 — CID 142881502
N-[5-bromo-2-[(2E,4Z)-1-hydroxyhexa-2,4-dien-3-yl]oxyphenyl]acetamide (PubChem CID 142881502) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is N-[5-bromo-2-[(2E,4Z)-1-hydroxyhexa-2,4-dien-3-yl]oxyphenyl]acetamide.
| Compound Name | N-[5-bromo-2-[(2E,4Z)-1-hydroxyhexa-2,4-dien-3-yl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 142881502 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-[5-bromo-2-[(2E,4Z)-1-hydroxyhexa-2,4-dien-3-yl]oxyphenyl]acetamide |
| SMILES | C/C=C\C(=C/CO)Oc1ccc(Br)cc1NC(C)=O |
| InChI | InChI=1S/C14H16BrNO3/c1-3-4-12(7-8-17)19-14-6-5-11(15)9-13(14)16-10(2)18/h3-7,9,17H,8H2,1-2H3,(H,16,18)/b4-3-,12-7+ |
| InChIKey | JJLBSROQTDXVNO-MJXUXYKOSA-N |
| XLogP | 3.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|