C16H22N2O2 — CID 142886716
N-methyl-4-[(2E,5Z)-7-methylocta-2,5-dien-3-yl]oxypyridine-2-carboxamide (PubChem CID 142886716) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-methyl-4-[(2E,5Z)-7-methylocta-2,5-dien-3-yl]oxypyridine-2-carboxamide.
| Compound Name | N-methyl-4-[(2E,5Z)-7-methylocta-2,5-dien-3-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 142886716 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-methyl-4-[(2E,5Z)-7-methylocta-2,5-dien-3-yl]oxypyridine-2-carboxamide |
| SMILES | C/C=C(\C/C=C\C(C)C)Oc1ccnc(C(=O)NC)c1 |
| InChI | InChI=1S/C16H22N2O2/c1-5-13(8-6-7-12(2)3)20-14-9-10-18-15(11-14)16(19)17-4/h5-7,9-12H,8H2,1-4H3,(H,17,19)/b7-6-,13-5+ |
| InChIKey | AEFVEPDXDPROPD-ZQNRWWJISA-N |
| XLogP | 3.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|