C17H26N2O2 — CID 142886721
ethane;N-methyl-4-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]oxypyridine-2-carboxamide (PubChem CID 142886721) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is ethane;N-methyl-4-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]oxypyridine-2-carboxamide.
| Compound Name | ethane;N-methyl-4-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 142886721 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | ethane;N-methyl-4-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]oxypyridine-2-carboxamide |
| SMILES | C/C=C(\C=C/C(C)C)Oc1ccnc(C(=O)NC)c1.CC |
| InChI | InChI=1S/C15H20N2O2.C2H6/c1-5-12(7-6-11(2)3)19-13-8-9-17-14(10-13)15(18)16-4;1-2/h5-11H,1-4H3,(H,16,18);1-2H3/b7-6-,12-5+; |
| InChIKey | CWNTXMRAOLQLBR-QIPXERRSSA-N |
| XLogP | 3.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|