C7H9NO — CID 142889473
5-aminocyclohepta-1,3,5-trien-1-ol (PubChem CID 142889473) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is 5-aminocyclohepta-1,3,5-trien-1-ol.
| Compound Name | 5-aminocyclohepta-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 142889473 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 5-aminocyclohepta-1,3,5-trien-1-ol |
| SMILES | NC1=CCC(O)=CC=C1 |
| InChI | InChI=1S/C7H9NO/c8-6-2-1-3-7(9)5-4-6/h1-4,9H,5,8H2 |
| InChIKey | XMJRIRDXQDYWGN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |