C14H24 — CID 142893691
3-(4,5-dimethylhex-5-enyl)cyclohexene (PubChem CID 142893691) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 3-(4,5-dimethylhex-5-enyl)cyclohexene.
| Compound Name | 3-(4,5-dimethylhex-5-enyl)cyclohexene |
|---|---|
| PubChem CID | 142893691 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 3-(4,5-dimethylhex-5-enyl)cyclohexene |
| SMILES | C=C(C)C(C)CCCC1C=CCCC1 |
| InChI | InChI=1S/C14H24/c1-12(2)13(3)8-7-11-14-9-5-4-6-10-14/h5,9,13-14H,1,4,6-8,10-11H2,2-3H3 |
| InChIKey | FTAREHJJKKKZCT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|