C19H31N — CID 143569848
(1Z,3Z)-3-but-3-en-2-yl-8-cyclohex-2-en-1-yl-N-methylocta-1,3-dien-1-amine (PubChem CID 143569848) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is (1Z,3Z)-3-but-3-en-2-yl-8-cyclohex-2-en-1-yl-N-methylocta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-3-but-3-en-2-yl-8-cyclohex-2-en-1-yl-N-methylocta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143569848 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | (1Z,3Z)-3-but-3-en-2-yl-8-cyclohex-2-en-1-yl-N-methylocta-1,3-dien-1-amine |
| SMILES | C=CC(C)C(/C=C\NC)=C/CCCCC1C=CCCC1 |
| InChI | InChI=1S/C19H31N/c1-4-17(2)19(15-16-20-3)14-10-6-9-13-18-11-7-5-8-12-18/h4,7,11,14-18,20H,1,5-6,8-10,12-13H2,2-3H3/b16-15-,19-14+ |
| InChIKey | CHRMHOCYUREEKC-QKYCKRCQSA-N |
| XLogP | 5.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|