C18H39N — CID 142893702
ethanamine;1-methyl-2,3,5-tri(propan-2-yl)cyclohexane (PubChem CID 142893702) has the molecular formula C18H39N and a molecular weight of 269.52 g/mol. Its IUPAC name is ethanamine;1-methyl-2,3,5-tri(propan-2-yl)cyclohexane.
| Compound Name | ethanamine;1-methyl-2,3,5-tri(propan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 142893702 |
| Molecular Formula | C18H39N |
| Molecular Weight | 269.52 g/mol |
| Exact Mass | 269.31 |
| IUPAC Name | ethanamine;1-methyl-2,3,5-tri(propan-2-yl)cyclohexane |
| SMILES | CC(C)C1CC(C)C(C(C)C)C(C(C)C)C1.CCN |
| InChI | InChI=1S/C16H32.C2H7N/c1-10(2)14-8-13(7)16(12(5)6)15(9-14)11(3)4;1-2-3/h10-16H,8-9H2,1-7H3;2-3H2,1H3 |
| InChIKey | CMLJCMNTUPZCGV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |