C21H44 — CID 143343617
1-butan-2-yl-2,3,5-tri(propan-2-yl)cyclohexane;ethane (PubChem CID 143343617) has the molecular formula C21H44 and a molecular weight of 296.58 g/mol. Its IUPAC name is 1-butan-2-yl-2,3,5-tri(propan-2-yl)cyclohexane;ethane.
| Compound Name | 1-butan-2-yl-2,3,5-tri(propan-2-yl)cyclohexane;ethane |
|---|---|
| PubChem CID | 143343617 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | 1-butan-2-yl-2,3,5-tri(propan-2-yl)cyclohexane;ethane |
| SMILES | CC.CCC(C)C1CC(C(C)C)CC(C(C)C)C1C(C)C |
| InChI | InChI=1S/C19H38.C2H6/c1-9-15(8)18-11-16(12(2)3)10-17(13(4)5)19(18)14(6)7;1-2/h12-19H,9-11H2,1-8H3;1-2H3 |
| InChIKey | GPSNMYSHUQBAFX-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |