C17H34O — CID 90951781
3-methyl-2,5,7-tri(propan-2-yl)cycloheptan-1-ol (PubChem CID 90951781) has the molecular formula C17H34O and a molecular weight of 254.46 g/mol. Its IUPAC name is 3-methyl-2,5,7-tri(propan-2-yl)cycloheptan-1-ol.
| Compound Name | 3-methyl-2,5,7-tri(propan-2-yl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 90951781 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 3-methyl-2,5,7-tri(propan-2-yl)cycloheptan-1-ol |
| SMILES | CC(C)C1CC(C)C(C(C)C)C(O)C(C(C)C)C1 |
| InChI | InChI=1S/C17H34O/c1-10(2)14-8-13(7)16(12(5)6)17(18)15(9-14)11(3)4/h10-18H,8-9H2,1-7H3 |
| InChIKey | DMFUEWFBFFRJNX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |