C11H21F — CID 123418337
1-fluoro-2,3-dimethyl-5-propan-2-ylcyclohexane (PubChem CID 123418337) has the molecular formula C11H21F and a molecular weight of 172.29 g/mol. Its IUPAC name is 1-fluoro-2,3-dimethyl-5-propan-2-ylcyclohexane.
| Compound Name | 1-fluoro-2,3-dimethyl-5-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 123418337 |
| Molecular Formula | C11H21F |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 1-fluoro-2,3-dimethyl-5-propan-2-ylcyclohexane |
| SMILES | CC(C)C1CC(C)C(C)C(F)C1 |
| InChI | InChI=1S/C11H21F/c1-7(2)10-5-8(3)9(4)11(12)6-10/h7-11H,5-6H2,1-4H3 |
| InChIKey | QMNVYJKAGLKGQF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |