C24H31ClO4 — CID 142901561
2-chloro-4-[3-[3-methyl-4-[(2-methylpropan-2-yl)oxymethoxy]phenyl]pentan-3-yl]benzoic acid (PubChem CID 142901561) has the molecular formula C24H31ClO4 and a molecular weight of 418.96 g/mol. Its IUPAC name is 2-chloro-4-[3-[3-methyl-4-[(2-methylpropan-2-yl)oxymethoxy]phenyl]pentan-3-yl]benzoic acid.
| Compound Name | 2-chloro-4-[3-[3-methyl-4-[(2-methylpropan-2-yl)oxymethoxy]phenyl]pentan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 142901561 |
| Molecular Formula | C24H31ClO4 |
| Molecular Weight | 418.96 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-chloro-4-[3-[3-methyl-4-[(2-methylpropan-2-yl)oxymethoxy]phenyl]pentan-3-yl]benzoic acid |
| SMILES | CCC(CC)(c1ccc(OCOC(C)(C)C)c(C)c1)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C24H31ClO4/c1-7-24(8-2,18-9-11-19(22(26)27)20(25)14-18)17-10-12-21(16(3)13-17)28-15-29-23(4,5)6/h9-14H,7-8,15H2,1-6H3,(H,26,27) |
| InChIKey | CZUQMSDRAQLWJN-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.96 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|