C13H16N2O — CID 142903262
N'-[(E)-3-(6-hydroxy-2,3-dihydro-1H-inden-1-yl)prop-1-enyl]methanimidamide (PubChem CID 142903262) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N'-[(E)-3-(6-hydroxy-2,3-dihydro-1H-inden-1-yl)prop-1-enyl]methanimidamide.
| Compound Name | N'-[(E)-3-(6-hydroxy-2,3-dihydro-1H-inden-1-yl)prop-1-enyl]methanimidamide |
|---|---|
| PubChem CID | 142903262 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N'-[(E)-3-(6-hydroxy-2,3-dihydro-1H-inden-1-yl)prop-1-enyl]methanimidamide |
| SMILES | N/C=N/C=C/CC1CCc2ccc(O)cc21 |
| InChI | InChI=1S/C13H16N2O/c14-9-15-7-1-2-10-3-4-11-5-6-12(16)8-13(10)11/h1,5-10,16H,2-4H2,(H2,14,15)/b7-1+ |
| InChIKey | FNQSIJTXYFTGKQ-LREOWRDNSA-N |
| XLogP | 2.31 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|