C20H40F3NO3S — CID 142904614
ethane;S-(2,2,2-trifluoroethyl) 6-[(2-butoxy-2-methylpropanoyl)amino]hexanethioate (PubChem CID 142904614) has the molecular formula C20H40F3NO3S and a molecular weight of 431.61 g/mol. Its IUPAC name is ethane;S-(2,2,2-trifluoroethyl) 6-[(2-butoxy-2-methylpropanoyl)amino]hexanethioate.
| Compound Name | ethane;S-(2,2,2-trifluoroethyl) 6-[(2-butoxy-2-methylpropanoyl)amino]hexanethioate |
|---|---|
| PubChem CID | 142904614 |
| Molecular Formula | C20H40F3NO3S |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | ethane;S-(2,2,2-trifluoroethyl) 6-[(2-butoxy-2-methylpropanoyl)amino]hexanethioate |
| SMILES | CC.CC.CCCCOC(C)(C)C(=O)NCCCCCC(=O)SCC(F)(F)F |
| InChI | InChI=1S/C16H28F3NO3S.2C2H6/c1-4-5-11-23-15(2,3)14(22)20-10-8-6-7-9-13(21)24-12-16(17,18)19;2*1-2/h4-12H2,1-3H3,(H,20,22);2*1-2H3 |
| InChIKey | XBLPJLIYQWKCLY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|