C28H44N2O3 — CID 142905963
1-[(Z,2E)-2-[2-(3,4-dimethoxy-5-propylphenyl)prop-2-enylidene]hex-3-enyl]piperidine-4-carboxamide;ethane (PubChem CID 142905963) has the molecular formula C28H44N2O3 and a molecular weight of 456.67 g/mol. Its IUPAC name is 1-[(Z,2E)-2-[2-(3,4-dimethoxy-5-propylphenyl)prop-2-enylidene]hex-3-enyl]piperidine-4-carboxamide;ethane.
| Compound Name | 1-[(Z,2E)-2-[2-(3,4-dimethoxy-5-propylphenyl)prop-2-enylidene]hex-3-enyl]piperidine-4-carboxamide;ethane |
|---|---|
| PubChem CID | 142905963 |
| Molecular Formula | C28H44N2O3 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.34 |
| IUPAC Name | 1-[(Z,2E)-2-[2-(3,4-dimethoxy-5-propylphenyl)prop-2-enylidene]hex-3-enyl]piperidine-4-carboxamide;ethane |
| SMILES | C=C(/C=C(\C=C/CC)CN1CCC(C(N)=O)CC1)c1cc(CCC)c(OC)c(OC)c1.CC |
| InChI | InChI=1S/C26H38N2O3.C2H6/c1-6-8-10-20(18-28-13-11-21(12-14-28)26(27)29)15-19(3)23-16-22(9-7-2)25(31-5)24(17-23)30-4;1-2/h8,10,15-17,21H,3,6-7,9,11-14,18H2,1-2,4-5H3,(H2,27,29);1-2H3/b10-8-,20-15+; |
| InChIKey | XDVUIAMJYOMWAU-PTNPAIIRSA-N |
| XLogP | 5.79 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|