C23H23F2N3O2S — CID 142907754
4-(difluoromethyl)-N-[2-(4-ethanimidoylphenyl)phenyl]-2-methyl-1,3-thiazole-5-carboxamide;prop-2-en-1-ol (PubChem CID 142907754) has the molecular formula C23H23F2N3O2S and a molecular weight of 443.52 g/mol. Its IUPAC name is 4-(difluoromethyl)-N-[2-(4-ethanimidoylphenyl)phenyl]-2-methyl-1,3-thiazole-5-carboxamide;prop-2-en-1-ol.
| Compound Name | 4-(difluoromethyl)-N-[2-(4-ethanimidoylphenyl)phenyl]-2-methyl-1,3-thiazole-5-carboxamide;prop-2-en-1-ol |
|---|---|
| PubChem CID | 142907754 |
| Molecular Formula | C23H23F2N3O2S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-(difluoromethyl)-N-[2-(4-ethanimidoylphenyl)phenyl]-2-methyl-1,3-thiazole-5-carboxamide;prop-2-en-1-ol |
| SMILES | C=CCO.[H]/N=C(\C)c1ccc(-c2ccccc2NC(=O)c2sc(C)nc2C(F)F)cc1 |
| InChI | InChI=1S/C20H17F2N3OS.C3H6O/c1-11(23)13-7-9-14(10-8-13)15-5-3-4-6-16(15)25-20(26)18-17(19(21)22)24-12(2)27-18;1-2-3-4/h3-10,19,23H,1-2H3,(H,25,26);2,4H,1,3H2/b23-11+; |
| InChIKey | GIWCMSCKHPTIHA-YDLOHEMZSA-N |
| XLogP | 5.86 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|