C23H21F2N3O2S — CID 59339498
N-[2-[4-[(Z)-cyclopropylmethoxyiminomethyl]phenyl]phenyl]-4-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 59339498) has the molecular formula C23H21F2N3O2S and a molecular weight of 441.50 g/mol. Its IUPAC name is N-[2-[4-[(Z)-cyclopropylmethoxyiminomethyl]phenyl]phenyl]-4-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[4-[(Z)-cyclopropylmethoxyiminomethyl]phenyl]phenyl]-4-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 59339498 |
| Molecular Formula | C23H21F2N3O2S |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[2-[4-[(Z)-cyclopropylmethoxyiminomethyl]phenyl]phenyl]-4-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C(F)F)c(C(=O)Nc2ccccc2-c2ccc(/C=N\OCC3CC3)cc2)s1 |
| InChI | InChI=1S/C23H21F2N3O2S/c1-14-27-20(22(24)25)21(31-14)23(29)28-19-5-3-2-4-18(19)17-10-8-15(9-11-17)12-26-30-13-16-6-7-16/h2-5,8-12,16,22H,6-7,13H2,1H3,(H,28,29)/b26-12- |
| InChIKey | NSAHXPCXOSLLQP-ZRGSRPPYSA-N |
| XLogP | 6.07 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|