C19H14F3N3O2S — CID 58801964
N-[2-[4-[(Z)-hydroxyiminomethyl]phenyl]phenyl]-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 58801964) has the molecular formula C19H14F3N3O2S and a molecular weight of 405.40 g/mol. Its IUPAC name is N-[2-[4-[(Z)-hydroxyiminomethyl]phenyl]phenyl]-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[4-[(Z)-hydroxyiminomethyl]phenyl]phenyl]-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 58801964 |
| Molecular Formula | C19H14F3N3O2S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | N-[2-[4-[(Z)-hydroxyiminomethyl]phenyl]phenyl]-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C(F)(F)F)c(C(=O)Nc2ccccc2-c2ccc(/C=N\O)cc2)s1 |
| InChI | InChI=1S/C19H14F3N3O2S/c1-11-24-17(19(20,21)22)16(28-11)18(26)25-15-5-3-2-4-14(15)13-8-6-12(7-9-13)10-23-27/h2-10,27H,1H3,(H,25,26)/b23-10- |
| InChIKey | LAVJDVJYIJJMRJ-RMORIDSASA-N |
| XLogP | 5.20 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|